5465-45-2 Usage
Description
[6-(4-chlorobenzoyl)-3,4-dimethyl-1-cyclohex-3-enyl]-(4-chlorophenyl)methanone is a complex chemical compound that features a cyclohexene ring with two methyl groups, a chlorobenzoyl group, and a 4-chlorophenyl group attached to the carbon of the ketone. The presence of a benzene ring with a chlorine substituent and a carbonyl group provides this compound with its ketone functionality. Its unique structure and potential reactivity make it a candidate for various applications across different sectors.
Uses
Used in Pharmaceutical Industry:
[6-(4-chlorobenzoyl)-3,4-dimethyl-1-cyclohex-3-enyl]-(4-chlorophenyl)methanone is used as an intermediate compound for the synthesis of various pharmaceutical products. Its unique structure allows for further chemical modifications, making it a valuable building block in the development of new drugs.
Used in Agricultural Industry:
In the agricultural sector, [6-(4-chlorobenzoyl)-3,4-dimethyl-1-cyclohex-3-enyl]-(4-chlorophenyl)methanone is used as a chemical intermediate in the production of pesticides and other agrochemicals. Its reactivity and structural features enable the creation of effective compounds for pest control and crop protection.
Used in Industrial Applications:
[6-(4-chlorobenzoyl)-3,4-dimethyl-1-cyclohex-3-enyl]-(4-chlorophenyl)methanone is also utilized in the industrial sector for the development of various chemical products, such as dyes, plastics, and coatings. Its versatility and potential for further chemical reactions make it a valuable component in the synthesis of a wide range of materials with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 5465-45-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 5 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5465-45:
(6*5)+(5*4)+(4*6)+(3*5)+(2*4)+(1*5)=102
102 % 10 = 2
So 5465-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H20Cl2O2/c1-13-11-19(21(25)15-3-7-17(23)8-4-15)20(12-14(13)2)22(26)16-5-9-18(24)10-6-16/h3-10,19-20H,11-12H2,1-2H3
5465-45-2Relevant articles and documents
A Mild and Simple Synthesis of Benzothiophenes and 4,7-Dihydrobenzothiophenes
Volz, Wolfgang,Voss, Juergen
, p. 670 - 674 (2007/10/02)
The synthesis of 1,3-disubstituted benzothiophenes and 4,7-dihydrobenzothiophenes from o-diacylbenzenes and 4,5-diacylcyclohexenes under very mild conditions is described.