5466-41-1 Usage
Description
4,6-DihydroxynicotinaMide, also known as DHN, is a chemical compound derived from nicotinamide, a form of vitamin B3. It is a white crystalline powder that is soluble in water. DHN possesses potential antioxidant and anti-inflammatory properties, making it a candidate for various medical and pharmaceutical applications. It has been investigated for its potential role in preventing and treating various diseases, including cancer, diabetes, and neurodegenerative disorders. Additionally, DHN has shown potential as a chelating agent, with studies exploring its ability to bind and remove heavy metals from the body. Due to its unique chemical properties and potential health benefits, 4,6-DihydroxynicotinaMide is a promising compound in various research areas.
Uses
Used in Pharmaceutical Applications:
4,6-DihydroxynicotinaMide is used as a pharmaceutical agent for its potential antioxidant and anti-inflammatory properties. It is being studied for its role in preventing and treating various diseases, such as cancer, diabetes, and neurodegenerative disorders.
Used in Chelating Applications:
In the environmental industry, 4,6-DihydroxynicotinaMide is used as a chelating agent for its ability to bind and remove heavy metals from the body, offering a potential solution for heavy metal toxicity and pollution.
Used in Research Applications:
4,6-DihydroxynicotinaMide is utilized as a research compound in various scientific studies, exploring its potential health benefits, disease prevention and treatment capabilities, and its unique chemical properties for further understanding and application development.
Check Digit Verification of cas no
The CAS Registry Mumber 5466-41-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 6 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5466-41:
(6*5)+(5*4)+(4*6)+(3*6)+(2*4)+(1*1)=101
101 % 10 = 1
So 5466-41-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O3/c7-6(11)3-2-8-5(10)1-4(3)9/h1-2H,(H2,7,11)(H2,8,9,10)