5466-71-7 Usage
General Description
2-(5-amino-9-phenyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-7-yl)acetonitrile is a chemical compound with a complex molecular structure. It contains a bicyclic ring system with a tetrazole ring, an amino group, and a phenyl group. The acetonitrile functional group is attached to the bicyclic system, giving it unique properties and potential applications. 2-(5-amino-9-phenyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen- 7-yl)acetonitrile may have potential pharmaceutical or biological activity due to its structural features, and it could be used in medicinal chemistry for the development of new drugs. The presence of the acetonitrile group also indicates that it may have uses in organic synthesis as a versatile building block for the creation of new chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 5466-71-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 6 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5466-71:
(6*5)+(5*4)+(4*6)+(3*6)+(2*7)+(1*1)=107
107 % 10 = 7
So 5466-71-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N6/c14-7-6-10-11-12(15)16-8-17-13(11)19(18-10)9-4-2-1-3-5-9/h1-5,8H,6H2,(H2,15,16,17)