5466-72-8 Usage
Molecular structure
2-(4-amino-5-imino-9-phenyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-2,7,10-t rien-7-yl)acetonitrile has a complex and unique structure, featuring a bicyclic nona-2,7,10-triene ring system, a phenyl group, and an amino-imino group.
Functional group
The compound contains an acetonitrile functional group, which is a cyano group (C≡N) attached to a methyl group (CH3).
Amino-imino group
The presence of an amino-imino group (-NH-N=) in the molecule contributes to its potential for specific interactions with biological targets.
Phenyl group
The phenyl group (a six-membered carbon ring with delocalized electrons) attached to the bicyclic ring system may influence the compound's stability, solubility, and interaction with biological targets.
Tetrazabicyclo ring system
The tetrazabicyclo[4.3.0]nona-2,7,10-triene ring system is a unique feature of this compound, which may contribute to its potential applications in pharmaceutical research.
Potential applications
2-(4-amino-5-imino-9-phenyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-2,7,10-t rien-7-yl)acetonitrile may have potential applications in pharmaceutical research due to its unique structure and the possibility of specific interactions with biological targets.
Further study required
To fully understand the properties and potential uses of this chemical compound, further study and analysis are necessary, including its chemical reactivity, stability, and bioavailability.
Check Digit Verification of cas no
The CAS Registry Mumber 5466-72-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 6 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5466-72:
(6*5)+(5*4)+(4*6)+(3*6)+(2*7)+(1*2)=108
108 % 10 = 8
So 5466-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N7/c14-7-6-10-11-12(15)19(16)8-17-13(11)20(18-10)9-4-2-1-3-5-9/h1-5,8,15H,6,16H2/b15-12-
