5467-97-0 Usage
Description
[3-(phenethylcarbamoyl)-2-phenethylimino-propyl] propanoate is a complex chemical compound derived from propanoic acid, featuring phenethylcarbamoyl, phenethylimino-propyl, and propanoate moieties. Its molecular structure, which includes a carbamoyl and imino-propyl group attached to phenethyl functional groups, suggests potential biological activity and possible applications in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
[3-(phenethylcarbamoyl)-2-phenethylimino-propyl] propanoate is used as a potential pharmaceutical compound for its possible biological activity. The presence of carbamoyl and imino-propyl groups in its structure indicates that it may have therapeutic properties, which warrant further research to fully understand its properties and potential uses.
Used in Drug Development:
In the field of drug development, [3-(phenethylcarbamoyl)-2-phenethylimino-propyl] propanoate may serve as a starting point for the synthesis of new drugs. Its unique molecular structure could be exploited to create novel therapeutic agents, targeting specific diseases or conditions. Further research and development are necessary to explore its potential in this application.
Used in Chemical Research:
[3-(phenethylcarbamoyl)-2-phenethylimino-propyl] propanoate can also be utilized in chemical research as a model compound to study the effects of its specific functional groups on biological systems. This could lead to a better understanding of how similar compounds interact with biological targets and contribute to their potential therapeutic effects.
Check Digit Verification of cas no
The CAS Registry Mumber 5467-97-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 7 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5467-97:
(6*5)+(5*4)+(4*6)+(3*7)+(2*9)+(1*7)=120
120 % 10 = 0
So 5467-97-0 is a valid CAS Registry Number.
InChI:InChI=1/C23H28N2O3/c1-2-23(27)28-18-21(24-15-13-19-9-5-3-6-10-19)17-22(26)25-16-14-20-11-7-4-8-12-20/h3-12H,2,13-18H2,1H3,(H,25,26)/b24-21-