5469-40-9 Usage
Description
(3E)-1-bromo-3-hydroxyimino-5-phenyl-pyrrolidin-2-one is a pyrrolidinone derivative with a molecular formula of C10H10BrNO2. It features a bromo and hydroxyimino group attached to a five-membered pyrrolidinone ring, which contributes to its potential applications in medicinal chemistry and drug discovery.
Uses
Used in Medicinal Chemistry:
(3E)-1-bromo-3-hydroxyimino-5-phenyl-pyrrolidin-2-one is used as a chemical intermediate for the synthesis of various organic compounds, including pharmaceuticals. Its unique structural features and potential biological activities make it a promising candidate for drug discovery.
Used in Drug Discovery:
(3E)-1-bromo-3-hydroxyimino-5-phenyl-pyrrolidin-2-one is used as a lead compound in drug discovery due to its potential to be developed into new therapeutic agents. The presence of the bromo and hydroxyimino functional groups could be exploited to create novel molecules with specific biological activities.
Used in Agrochemicals:
(3E)-1-bromo-3-hydroxyimino-5-phenyl-pyrrolidin-2-one is also used as a chemical intermediate for the synthesis of agrochemicals, where its structural features may contribute to the development of new pesticides or other agricultural products.
However, it is important to note that further research is needed to fully understand the properties and potential uses of (3E)-1-bromo-3-hydroxyimino-5-phenyl-pyrrolidin-2-one in these applications.
Check Digit Verification of cas no
The CAS Registry Mumber 5469-40-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 9 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5469-40:
(6*5)+(5*4)+(4*6)+(3*9)+(2*4)+(1*0)=109
109 % 10 = 9
So 5469-40-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrN2O2/c11-13-9(6-8(12-15)10(13)14)7-4-2-1-3-5-7/h1-5,9,15H,6H2/b12-8-
