5469-54-5 Usage
General Description
3-[4-(4-bromophenyl)-5-phenyl-3H-imidazol-2-yl]phenol is a chemical compound with a complex molecular structure. It contains a phenol group attached to a 3H-imidazole ring, which in turn is connected to a bromophenyl and a phenyl group. 3-[4-(4-bromophenyl)-5-phenyl-3H-imidazol-2-yl]phenol has potential applications in the field of pharmaceuticals and medicinal chemistry, as imidazole derivatives have been studied for their various biological activities such as anti-inflammatory, anti-tumor, and antimicrobial properties. The bromophenyl group in the molecule is also of interest due to its potential impact on the compound's pharmacological properties. Further research and study are needed to fully understand the potential uses and effects of 3-[4-(4-bromophenyl)-5-phenyl-3H-imidazol-2-yl]phenol.
Check Digit Verification of cas no
The CAS Registry Mumber 5469-54-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 9 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5469-54:
(6*5)+(5*4)+(4*6)+(3*9)+(2*5)+(1*4)=115
115 % 10 = 5
So 5469-54-5 is a valid CAS Registry Number.
InChI:InChI=1/C21H15BrN2O/c22-17-11-9-15(10-12-17)20-19(14-5-2-1-3-6-14)23-21(24-20)16-7-4-8-18(25)13-16/h1-13,25H,(H,23,24)