5471-32-9 Usage
Description
1-(2-fluoronaphthalen-1-yl)ethanone, also known as 2'-fluoroacetophenone or 2-fluoro-1-naphthalenyl ethanone, is a fluoroaromatic ketone with the molecular formula C12H11FO. It features an aromatic ring structure with a fluorine substitution at the 2-position and a ketone functional group attached to an ethyl chain. This chemical compound is widely used as a reagent in organic synthesis and medicinal chemistry research, serving as a building block for more complex organic molecules. It holds potential applications in the pharmaceutical and material science industries, but it should be handled with care due to its potential hazards and toxic properties.
Uses
Used in Organic Synthesis:
1-(2-fluoronaphthalen-1-yl)ethanone is used as a reagent for creating complex organic molecules, leveraging its fluoroaromatic ketone structure to facilitate various chemical reactions and the formation of new compounds.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1-(2-fluoronaphthalen-1-yl)ethanone is used as a building block to develop novel pharmaceuticals. Its unique structure allows for the design and synthesis of potential drug candidates with specific therapeutic properties.
Used in Pharmaceutical Industry:
1-(2-fluoronaphthalen-1-yl)ethanone is used as an intermediate in the synthesis of pharmaceutical compounds. Its fluorine substitution can influence the pharmacokinetics and pharmacodynamics of the resulting drug molecules, potentially enhancing their efficacy and safety.
Used in Material Science:
Within the material science industry, 1-(2-fluoronaphthalen-1-yl)ethanone is used to develop new materials with specific properties. Its incorporation into polymers or other materials can lead to enhanced performance characteristics, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 5471-32-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,7 and 1 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5471-32:
(6*5)+(5*4)+(4*7)+(3*1)+(2*3)+(1*2)=89
89 % 10 = 9
So 5471-32-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H9FO/c1-8(14)12-10-5-3-2-4-9(10)6-7-11(12)13/h2-7H,1H3
