5472-35-5 Usage
Chemical structure
Urea derivative with a substituted phenyl group and an amino group attached to the same nitrogen atom
Common use
Organic synthesis as a reagent for the preparation of various functionalized urea derivatives
Pharmacological properties
Studied for potential anti-cancer properties
Medicinal properties
Investigated for its role in the development of new materials and as a building block for the design of novel organic compounds
Check Digit Verification of cas no
The CAS Registry Mumber 5472-35-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,7 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5472-35:
(6*5)+(5*4)+(4*7)+(3*2)+(2*3)+(1*5)=95
95 % 10 = 5
So 5472-35-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O/c1-6-2-4-7(5-3-6)11(10)8(9)12/h2-5H,10H2,1H3,(H2,9,12)
