5472-46-8 Usage
General Description
Ethyl 4-amino-2-methylpyrimidine-5-carboxylate is an organic chemical compound that belongs to the class of pyrimidines, which are aromatic heterocyclic compounds composed of two nitrogen atoms and four carbon atoms in a six-membered ring structure. This specific compound is characterized by other functional groups attached to the pyrimidine ring, including an ethyl carboxylate group at the 5-position, an amino group at the 4-position and a methyl group at the 2-position. Its systematic chemical name suggests its molecular structure. Its properties and reactivity will depend on its specific chemical structure, which includes various chemical groups that can participate in chemical reactions. ethyl 4-amino-2-methylpyrimidine-5-carboxylate may be used in various chemical syntheses or research applications, particularly due to its nitrogen-containing heterocyclic structure.
Check Digit Verification of cas no
The CAS Registry Mumber 5472-46-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,7 and 2 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5472-46:
(6*5)+(5*4)+(4*7)+(3*2)+(2*4)+(1*6)=98
98 % 10 = 8
So 5472-46-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O2/c1-3-13-8(12)6-4-10-5(2)11-7(6)9/h4H,3H2,1-2H3,(H2,9,10,11)
