54828-63-6 Usage
General Description
6-Bromo-1-methoxynaphthalene is a chemical compound that belongs to the class of organic compounds known as bromonaphthalenes. This category is comprised of compounds containing a naphthalene ring where one or more carbon atoms are substituted by a bromine atom. This specific compound gets its name from the presence of a bromine atom attached at the 6th position and a methoxyl group attached at the 1st position on the naphthalene ring. It's predominantly used in scientific research, primarily in chemistry laboratories, for its unique reactivity and other chemical properties. The exact physical properties such as melting and boiling point may vary depending on its specific arrangement and other conditions. Its molecular formula is C11H9BrO.
Check Digit Verification of cas no
The CAS Registry Mumber 54828-63-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,8,2 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 54828-63:
(7*5)+(6*4)+(5*8)+(4*2)+(3*8)+(2*6)+(1*3)=146
146 % 10 = 6
So 54828-63-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H9BrO/c1-13-11-4-2-3-8-7-9(12)5-6-10(8)11/h2-7H,1H3
54828-63-6Relevant articles and documents
ORGANIC ELECTROLUMINESCENT MATERIALS AND DEVICES
-
Paragraph 0152; 0153, (2019/04/08)
A compound comprising a first ligand LA having a Formula selected from: is disclosed. In the Formulas rings B and C are 5-membered or 6-membered aromatic or heteroaromatic ring; Z1, Z2, X1, X2, X3, X4, X5, and X6 are each C or N, but X1, X2, X3, or X4 is C when it forms a direct bond to Z2; Y is selected from CRR′, NR′, O, S, and Se; R, R′, RA, RB, RC, and RD are each selected from a variety of substituents; the ligand LA is coordinated to a metal M by the dashed lines, and optionally to other ligands. Organic light emitting devices and consumer products containing the compounds are also disclosed.