549-06-4 Usage
General Description
Stictic acid is a secondary metabolite produced by lichen-forming fungi and is a type of depside, a class of organic compounds. It is commonly found in various species of lichens and contributes to their protective and antimicrobial properties. Stictic acid has been found to exhibit various biological activities, including antioxidant, anti-inflammatory, and antibacterial effects. Additionally, stictic acid has shown potential in inhibiting the growth of cancer cells and has attracted interest in its potential use for the development of new pharmaceuticals. Overall, stictic acid is a bioactive compound that holds promise for various medical and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 549-06-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,4 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 549-06:
(5*5)+(4*4)+(3*9)+(2*0)+(1*6)=74
74 % 10 = 4
So 549-06-4 is a valid CAS Registry Number.
InChI:InChI=1/C19H14O9/c1-6-4-9(25-3)8(5-20)15-10(6)17(22)27-14-7(2)13(21)11-12(16(14)26-15)19(24)28-18(11)23/h4-5,19,21,24H,1-3H3