549-17-7 Usage
Description
OXYAYANINA, also known as a trihydroxyflavone, is a flavone compound characterized by the presence of hydroxy groups at positions 5, 2', and 5', and methoxy groups at positions 3, 7, and 4'. This unique molecular structure endows OXYAYANINA with potential applications in various fields due to its chemical properties.
Uses
1. Used in Pharmaceutical Industry:
OXYAYANINA is used as a pharmaceutical compound for its potential therapeutic effects. The expression is: OXYAYANINA is used as a therapeutic agent for its unique molecular structure that may contribute to various medicinal applications.
2. Used in Chemical Research:
OXYAYANINA serves as a subject of interest in chemical research due to its distinct substitution pattern. The expression is: OXYAYANINA is used as a research subject for understanding its chemical properties and potential interactions with other molecules.
3. Used in Drug Development:
Given its unique structure, OXYAYANINA may be utilized in the development of new drugs targeting specific conditions. The expression is: OXYAYANINA is used as a lead compound for drug development, potentially leading to the creation of novel therapeutic agents.
4. Used in Cosmetics Industry:
Owing to its chemical properties, OXYAYANINA may find applications in the cosmetics industry, potentially serving as an active ingredient in skincare or hair care products. The expression is: OXYAYANINA is used as an active ingredient in the cosmetics industry for its potential benefits to skin and hair health.
5. Used in Agricultural Applications:
OXYAYANINA's properties may also be harnessed in the agricultural sector, possibly for the development of new pesticides or fertilizers. The expression is: OXYAYANINA is used as a component in agricultural applications for its potential role in enhancing crop protection or nutrition.
Please note that the specific applications and reasons mentioned above are hypothetical and would require further research and validation to confirm their feasibility and effectiveness.
Check Digit Verification of cas no
The CAS Registry Mumber 549-17-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,4 and 9 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 549-17:
(5*5)+(4*4)+(3*9)+(2*1)+(1*7)=77
77 % 10 = 7
So 549-17-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H16O8/c1-23-8-4-12(21)15-14(5-8)26-17(18(25-3)16(15)22)9-6-11(20)13(24-2)7-10(9)19/h4-7,19-21H,1-3H3