5493-64-1 Usage
Derivative of acetohydrazide
The compound is derived from acetohydrazide, which is a chemical structure that is modified or "substituted" in some way to create the new compound.
Substituted biphenyl group
The compound contains a biphenyl group (a type of chemical structure consisting of two six-carbon rings connected by a single bond) that has been modified or "substituted" with another chemical group.
Building block in the synthesis of various organic compounds
The compound is commonly used in research and pharmaceutical applications as a starting material or "building block" in the synthesis of other organic compounds.
Ligand for metal catalysts
The compound can bind to metal catalysts (substances that increase the rate of a chemical reaction) and is used in the study of coordination chemistry (the branch of chemistry concerned with the study of compounds in which metal ions are bonded to other atoms or molecules).
Potential biological activities
The compound is known for its potential biological activities, meaning that it may have an effect on living organisms.
Potential as a drug candidate
The compound is currently being investigated for its potential as a drug candidate, meaning that it is being studied for its potential use in the treatment of various diseases or medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 5493-64-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,9 and 3 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5493-64:
(6*5)+(5*4)+(4*9)+(3*3)+(2*6)+(1*4)=111
111 % 10 = 1
So 5493-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N2O2/c15-16-14(17)10-18-13-9-5-4-8-12(13)11-6-2-1-3-7-11/h1-9H,10,15H2,(H,16,17)
