5516-20-1 Usage
Benzonitrile family member
It belongs to a group of chemical compounds that have a core structure of a benzene ring attached to a cyanide group (CN).
Chlorophenylvinyl group
A functional group within the compound that consists of a chlorine atom attached to a phenyl ring, which is connected to a vinyl group (C=C).
2H-naphtho[1,2-d]triazol-2-yl group
A heterocyclic compound with a naphthalene backbone and a triazole ring, which is attached to the benzonitrile core structure.
Potential applications in medicine and pharmacology
The compound may exhibit pharmacological activity due to its unique structure and functional groups, making it a candidate for further research in drug development and therapeutic applications.
Need for further research and studies
To explore the potential uses and effects of this chemical compound, additional studies and investigations are required to determine its properties, activity, and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 5516-20-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,5,1 and 6 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5516-20:
(6*5)+(5*5)+(4*1)+(3*6)+(2*2)+(1*0)=81
81 % 10 = 1
So 5516-20-1 is a valid CAS Registry Number.
InChI:InChI=1/C25H15ClN4/c26-21-11-6-17(7-12-21)5-8-18-9-13-22(15-20(18)16-27)30-28-24-14-10-19-3-1-2-4-23(19)25(24)29-30/h1-15H/b8-5+