55174-65-7 Usage
Description
[R(R,R)]-2-(benzylideneamino)-1-(4-nitrophenyl)propane-1,3-diol is a complex chiral molecule with a benzylideneamino group and a nitrophenyl group. It features two chiral centers, denoted as R, resulting in a pair of enantiomers. [R(R,R)]-2-(benzylideneamino)-1-(4-nitrophenyl)propane-1,3-diol has a propane backbone and contains two hydroxy (OH) groups, making it a diol. Its unique structure and potential biological activity make it valuable for scientific research and pharmaceutical development. However, caution is advised in handling and using this compound due to its potential reactivity and toxicity.
Uses
Used in Scientific Research:
[R(R,R)]-2-(benzylideneamino)-1-(4-nitrophenyl)propane-1,3-diol is used as a research compound for studying its unique structure and potential interactions with biological systems. Its chiral nature and functional groups allow for exploration into various areas of chemistry and biology.
Used in Pharmaceutical Development:
In the pharmaceutical industry, [R(R,R)]-2-(benzylideneamino)-1-(4-nitrophenyl)propane-1,3-diol is used as a lead compound for the development of new drugs. Its complex structure and potential biological activity make it a promising candidate for further investigation into its therapeutic properties and applications.
Used in Chemical Synthesis:
[R(R,R)]-2-(benzylideneamino)-1-(4-nitrophenyl)propane-1,3-diol can be used as a synthetic building block in the creation of more complex molecules. Its unique structure and functional groups can be exploited to synthesize novel compounds with potential applications in various fields.
Used in Material Science:
[R(R,R)]-2-(benzylideneamino)-1-(4-nitrophenyl)propane-1,3-diol's structural properties may also make it useful in the field of material science, where it could be explored for its potential to create new materials with unique properties.
Check Digit Verification of cas no
The CAS Registry Mumber 55174-65-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,1,7 and 4 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 55174-65:
(7*5)+(6*5)+(5*1)+(4*7)+(3*4)+(2*6)+(1*5)=127
127 % 10 = 7
So 55174-65-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H16N2O4/c19-11-15(17-10-12-4-2-1-3-5-12)16(20)13-6-8-14(9-7-13)18(21)22/h1-10,15-16,19-20H,11H2/b17-10+/t15-,16-/m1/s1
