5536-40-3 Usage
General Description
"(4-Hydroxy-2,6-Dimethyl-pyrimidin-5-yl)-acetic acid is a scientific term referring to a chemical compound. Like its name suggests, it's a pyrimidine derivative, a class of organic compounds characterized by a six-membered ring containing nitrogen atoms. This particular one is further characterized by the presence of several functional groups such as hydroxy, methyl and acetic acid groups attached to the pyrimidine ring. The structural configuration implies the chemical’s potential of having varied interactions and consequential roles in several biological activities. Its exact properties and applications can vary significantly depending on its state and conditions such as temperature and pressure, like most chemicals. Further experimentation and research could provide more details about its potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 5536-40-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,5,3 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5536-40:
(6*5)+(5*5)+(4*3)+(3*6)+(2*4)+(1*0)=93
93 % 10 = 3
So 5536-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O3/c1-4-6(3-7(11)12)8(13)10-5(2)9-4/h3H2,1-2H3,(H,11,12)(H,9,10,13)
5536-40-3Relevant articles and documents
Dimethyl acetylsuccinate as a versatile synthon in heterocyclic chemistry - A facile synthesis of heterocyclic acetic acid derivatives
Craig, G. Wayne,Eberle, Martin,Lamberth, Clemens,Vettiger, Thomas
, p. 504 - 507 (2007/10/03)
The preparation of novel acetic acid derivatives of pyrazole 3a,b and pyrimidine 2a-e is achieved by condensation of dimethyl acetylsuccinate (1) with appropriate reaction partners. Also triethyl 1,1,2-ethanetricarboxylate (6) is a valuable starting material, which is demonstrated by the synthesis of previously unknown pyrimidin-5-yl acetates. Wiley-VCH Verlag GmbH, 2000.
