55364-85-7 Usage
General Description
Methyl 3-(pyridin-2-ylamino)propanoate is a specialty chemical compound, known for its reactivity. It carries the linear formula of C10H12N2O2, indicating that it's composed of ten carbon atoms, twelve hydrogen atoms, two nitrogen atoms, and two oxygen atoms. Its molecular weight is approximately 192.21 g/mol. This chemical finds applications in various domains, particularly in laboratories for chemical syntheses, thanks to its unique characteristics favorable to underlying chemical reactions. As with all chemical substances, careful handling, storage, and disposal of methyl 3-(pyridin-2-ylamino)propanoate are necessary due to potential health and environmental hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 55364-85-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,3,6 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 55364-85:
(7*5)+(6*5)+(5*3)+(4*6)+(3*4)+(2*8)+(1*5)=137
137 % 10 = 7
So 55364-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2/c1-13-9(12)5-7-11-8-4-2-3-6-10-8/h2-4,6H,5,7H2,1H3,(H,10,11)
