55457-11-9 Usage
General Description
The chemical Pyrazolo[1,5-a]-1,3,5-triazin-4(1H)-one, 7-methyl- (9CI) is a heterocyclic compound that consists of a pyrazolo[1,5-a]pyrimidine core with a methyl group at the seventh position. It is commonly used in pharmaceutical research and drug development due to its potential biological activities, such as being a potential antitumor and anti-inflammatory agent. The compound's structure and properties make it a promising candidate for drug discovery and therapeutic application in various disease conditions. Additionally, it has been studied for its potential role in modulating enzyme activity and cellular signaling pathways, making it an important target for further research and investigation in the field of medicinal chemistry and pharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 55457-11-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,4,5 and 7 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 55457-11:
(7*5)+(6*5)+(5*4)+(4*5)+(3*7)+(2*1)+(1*1)=129
129 % 10 = 9
So 55457-11-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4O/c1-4-2-5-7-3-8-6(11)10(5)9-4/h2-3,9H,1H3