55816-92-7 Usage
General Description
2,4-diethoxy-6-methylpyrimidine is a chemical compound with the molecular formula C10H14N2O2. It is a pyrimidine derivative with two ethoxy groups and a methyl group attached to the pyrimidine ring. 2,4-diethoxy-6-methylpyrimidine is used in organic synthesis and medicinal chemistry as a building block for the preparation of various pharmaceuticals and agrochemicals. Its structure and properties make it a valuable precursor for the synthesis of biologically active compounds, and it has potential applications in the development of new drugs and agricultural products. Additionally, 2,4-diethoxy-6-methylpyrimidine has been studied for its antifungal and antimicrobial activity, further demonstrating its potential for use in the pharmaceutical and agricultural industries.
Check Digit Verification of cas no
The CAS Registry Mumber 55816-92-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,8,1 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 55816-92:
(7*5)+(6*5)+(5*8)+(4*1)+(3*6)+(2*9)+(1*2)=147
147 % 10 = 7
So 55816-92-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2O2/c1-4-12-8-6-7(3)10-9(11-8)13-5-2/h6H,4-5H2,1-3H3
