5613-24-1 Usage
General Description
6-Chloro-2,3-dimethyl-benzoic acid is a chemical compound with the molecular formula C9H9ClO2. It is a crystalline solid that is often used as an intermediate in the synthesis of pharmaceutical drugs and agrochemicals. 6-chloro-2,3-dimethyl-benzoic acid is a derivative of benzoic acid, which is a common building block in organic chemistry due to its reactivity and versatility. The presence of the chloro and methyl groups in the molecular structure of 6-chloro-2,3-dimethyl-benzoic acid gives it specific properties that make it useful in various chemical reactions and applications. Its precise uses and applications depend on its intended role in a specific chemical process or formulation.
Check Digit Verification of cas no
The CAS Registry Mumber 5613-24-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,1 and 3 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5613-24:
(6*5)+(5*6)+(4*1)+(3*3)+(2*2)+(1*4)=81
81 % 10 = 1
So 5613-24-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9ClO2/c1-5-3-4-7(10)8(6(5)2)9(11)12/h3-4H,1-2H3,(H,11,12)
