56181-66-9 Usage
Description
3-[1,1'-Biphenyl]-4-yl-1,2,3,4-tetrahydro-1-naphthol is a synthetic intermediate with a complex molecular structure, featuring a biphenyl group attached to a tetrahydro-1-naphthol moiety. 3-[1,1'-Biphenyl]-4-yl-1,2,3,4-tetrahydro-1-naphthol plays a crucial role in the synthesis of various pharmaceuticals and agrochemicals due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
3-[1,1'-Biphenyl]-4-yl-1,2,3,4-tetrahydro-1-naphthol is used as a synthetic intermediate for the production of Difenacoum (D445350), a 4-hydroxycourmarin derivative and second-generation anticoagulant rodenticide. It is specifically designed to target rodent pests such as rats and mice, providing an effective and long-lasting solution for pest control.
Used in Agrochemical Industry:
3-[1,1'-Biphenyl]-4-yl-1,2,3,4-tetrahydro-1-naphthol is also utilized in the synthesis of other agrochemicals, contributing to the development of innovative and efficient pest control solutions. Its unique structure allows for the creation of compounds with enhanced properties, such as increased stability and improved bioavailability, making it a valuable asset in the agrochemical field.
Check Digit Verification of cas no
The CAS Registry Mumber 56181-66-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,1,8 and 1 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 56181-66:
(7*5)+(6*6)+(5*1)+(4*8)+(3*1)+(2*6)+(1*6)=129
129 % 10 = 9
So 56181-66-9 is a valid CAS Registry Number.
InChI:InChI=1/C22H20O/c23-22-15-20(14-19-8-4-5-9-21(19)22)18-12-10-17(11-13-18)16-6-2-1-3-7-16/h1-13,20,22-23H,14-15H2