5623-89-2 Usage
General Description
2-Cyclopentyl hexanoic acid, also known as Pivaric acid, is a chemical compound with the molecular formula C11H20O2. It is a carboxylic acid that has a cyclopentyl group attached to a hexanoic acid chain. 2-CYCLOPENTYL HEXANOIC ACID is commonly used in the synthesis of various pharmaceuticals and fragrances, due to its unique structure and properties. It is also used as a flavoring agent in the food industry, adding a pleasant and subtle aroma to various products. Additionally, 2-Cyclopentyl hexanoic acid has been studied for its potential anti-inflammatory and antioxidant properties, making it a subject of interest in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 5623-89-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,2 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5623-89:
(6*5)+(5*6)+(4*2)+(3*3)+(2*8)+(1*9)=102
102 % 10 = 2
So 5623-89-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H20O2/c1-2-3-8-10(11(12)13)9-6-4-5-7-9/h9-10H,2-8H2,1H3,(H,12,13)