5626-43-7 Usage
General Description
N-(5-methoxy-3-oxo-8-oxa-7,9-diazabicyclo[4.3.0]nona-1,4,6-trien-2-yl)acetamide is a chemical compound with a complex molecular structure that includes a diazabicyclo nonane ring system. It is characterized by the presence of a methoxy group, a carbonyl group, and an amide functional group. N-(5-methoxy-3-oxo-8-oxa-7,9-diazabicyclo[4.3.0]nona-1,4,6-trien-2-yl)acetamide is likely to exhibit biological activity due to its complex structure and may have potential applications in the pharmaceutical or chemical industries. However, further research and testing would be needed to determine its specific properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 5626-43-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,2 and 6 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 5626-43:
(6*5)+(5*6)+(4*2)+(3*6)+(2*4)+(1*3)=97
97 % 10 = 7
So 5626-43-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O4/c1-4(13)10-7-5(14)3-6(15-2)8-9(7)12-16-11-8/h3,12H,1-2H3,(H,10,13)