5628-44-4 Usage
General Description
4-Amino-2,3-Dimethylbenzoic Acid is a chemical compound identified by the CAS number 30485-55-1. As suggested by its name, its structure contains a benzene ring, further modified by the presence of two methyl groups, an amino group, and a carboxylic acid group. 4-AMINO-2,3-DIMETHYL-BENZOIC ACID is usually used in research and development settings. It has potential application in various fields of scientific research. Because of the presence of both the carboxylic acid group and the amino group, it can exhibit different chemical behaviors, possibly enabling it to act as an intermediate in the synthesis of more complex chemical compounds. However, specific safety and handling precautions must be adhered to due to its potential hazards and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 5628-44-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,2 and 8 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5628-44:
(6*5)+(5*6)+(4*2)+(3*8)+(2*4)+(1*4)=104
104 % 10 = 4
So 5628-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO2/c1-5-6(2)8(10)4-3-7(5)9(11)12/h3-4H,10H2,1-2H3,(H,11,12)
