56378-59-7 Usage
Description
[2(3H)-benzothiazolethione]dichlorozinc is a chemical compound derived from benzothiazolethione and zinc chloride, characterized by its excellent catalytic activity and high stability in promoting the formation of carbon-carbon and carbon-heteroatom bonds. It is commonly used as a catalyst in organic reactions, particularly in the synthesis of various chemical compounds, and has shown potential in the conversion of carbon dioxide into valuable chemicals, making it a promising candidate for sustainable and environmentally friendly chemical synthesis processes.
Uses
Used in Organic Synthesis:
[2(3H)-benzothiazolethione]dichlorozinc is used as a catalyst for the synthesis of various chemical compounds, enhancing the efficiency and selectivity of the reactions.
Used in Carbon Dioxide Conversion:
[2(3H)-benzothiazolethione]dichlorozinc is used as a catalyst for the conversion of carbon dioxide into valuable chemicals, contributing to sustainable and environmentally friendly chemical synthesis processes.
Used in Pharmaceutical Industry:
[2(3H)-benzothiazolethione]dichlorozinc is used as a catalyst in the synthesis of pharmaceutical compounds, potentially leading to the development of new drugs and therapies.
Used in Chemical Research:
[2(3H)-benzothiazolethione]dichlorozinc is used as a catalyst in academic and industrial research, facilitating the discovery of new chemical reactions and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 56378-59-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,3,7 and 8 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 56378-59:
(7*5)+(6*6)+(5*3)+(4*7)+(3*8)+(2*5)+(1*9)=157
157 % 10 = 7
So 56378-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H5NS2.2ClH.Zn/c9-7-8-5-3-1-2-4-6(5)10-7;;;/h1-4H,(H,8,9);2*1H;/q;;;+2/p-2