5646-98-0 Usage
General Description
5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a chemical compound with the molecular formula C20H14N4O2. It is a heterocyclic compound containing a pyrazole ring and a pyrimidine ring connected by a carboxylic acid group. 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid has potential pharmacological and biological activities, and it is being studied for its potential use in the development of new drugs. Its structural features make it a promising candidate for further research in drug discovery and development. Additionally, it may have applications in the fields of medicinal chemistry and pharmaceutical sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 5646-98-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,4 and 6 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5646-98:
(6*5)+(5*6)+(4*4)+(3*6)+(2*9)+(1*8)=120
120 % 10 = 0
So 5646-98-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H13N3O2/c23-19(24)16-12-18-20-15(13-7-3-1-4-8-13)11-17(22(18)21-16)14-9-5-2-6-10-14/h1-12H,(H,23,24)