56609-03-1 Usage
General Description
1-benzhydrylpiperazinium chloride is a chemical compound that belongs to the piperazinium class of organic compounds. It is a salt composed of a piperazinium cation and a chloride anion. 1-benzhydrylpiperazinium chloride has been investigated for its potential pharmacological properties, including its use as a potential nicotinic acetylcholine receptor agonist. 1-benzhydrylpiperazinium chloride is also known for its role in the synthesis of various organic compounds and its potential applications in medicinal chemistry. Furthermore, it has been studied for its potential effects on the central nervous system, making it a subject of interest in neuropharmacology research. Overall, 1-benzhydrylpiperazinium chloride has demonstrated potential in various pharmacological and neurological applications, making it a compound of interest in the field of organic and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 56609-03-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,6,0 and 9 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 56609-03:
(7*5)+(6*6)+(5*6)+(4*0)+(3*9)+(2*0)+(1*3)=131
131 % 10 = 1
So 56609-03-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H20N2.ClH/c1-3-7-15(8-4-1)17(16-9-5-2-6-10-16)19-13-11-18-12-14-19;/h1-10,17-18H,11-14H2;1H