5701-86-0 Usage
General Description
2,3-Dimethoxy-5-Methyl-Benzaldehyde is a specialized aromatic aldehyde compound. Aldehydes in general are organic compounds that contain a formyl group. This chemical is notable for its various contexts of use due to its structural properties. It has two methoxy groups attached to the second and third carbon atoms of the benzene ring, a methyl group attached to the fifth carbon atom and an aldehyde group attached to the first carbon atom. The presence of these groups generally leads to different physical and chemical properties such as solubility, density, molecular weight, and others. Potential applications can range from uses in chemical synthesis, as intermediates in production of other chemicals, a precursor in various laboratory experiments, and so on. However, proper care in handling and usage is necessary due to potential hazards with exposure or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 5701-86-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,7,0 and 1 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5701-86:
(6*5)+(5*7)+(4*0)+(3*1)+(2*8)+(1*6)=90
90 % 10 = 0
So 5701-86-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H17ClN2O5S/c1-2-26-18(23)15-11-5-3-4-6-14(11)27-17(15)20-16(22)12-9-10(19)7-8-13(12)21(24)25/h7-9H,2-6H2,1H3,(H,20,22)
5701-86-0Relevant articles and documents
Total synthesis of (±)-herbertenediol
Srikrishna,Satyanarayana
, p. 2892 - 2900 (2007/10/03)
A formal total synthesis of the sesquiterpene (±)-herbertenediol and its dimers mastigophorenes A-D has been accomplished, starting from vanillin via 2,3-dimethoxy-5-methylbenzaldehyde. A combination of Claisen rearrangement and ring-closing metathesis reactions were employed for the generation of the two vicinal quaternary carbons on a cyclopentane ring.