57043-35-3 Usage
General Description
Monoacryloyloxyethyl hexahydrophthalate (MAHP) is a chemical compound used primarily as a crosslinking agent in the production of various polymeric materials. It is a monofunctional acrylate derivative of hexahydrophthalic acid, which makes it an effective crosslinking component in polymer formulations. MAHP is commonly used in the production of adhesives, coatings, and composites, where it imparts improved mechanical and thermal properties to the final products. Additionally, MAHP is known for its ability to enhance the adhesion and chemical resistance of polymeric materials, making it a versatile and valuable component in various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 57043-35-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,0,4 and 3 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 57043-35:
(7*5)+(6*7)+(5*0)+(4*4)+(3*3)+(2*3)+(1*5)=113
113 % 10 = 3
So 57043-35-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O6/c1-2-11(14)18-7-8-19-13(17)10-6-4-3-5-9(10)12(15)16/h2,9-10H,1,3-8H2,(H,15,16)
