57075-34-0 Usage
Description
5,6-DIAMINO-2-(2-PROPOXYPHENYL)-4(1H)PYRIMIDINONE, also known as 5,6-Diamino-2-(2-propoxyphenyl)pyrimidin-4(3H)-one (CAS# 57075-34-0), is a chemical compound with a yellow solid appearance. It is primarily recognized for its utility in organic synthesis, making it a valuable component in the development of various chemical products and materials.
Uses
Used in Organic Synthesis:
5,6-DIAMINO-2-(2-PROPOXYPHENYL)-4(1H)PYRIMIDINONE is used as a key compound in organic synthesis for its ability to contribute to the formation of complex molecular structures. Its unique chemical properties allow it to be a versatile building block in the creation of a wide range of chemical products, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5,6-DIAMINO-2-(2-PROPOXYPHENYL)-4(1H)PYRIMIDINONE is used as an intermediate in the development of new drugs. Its chemical structure can be modified and combined with other molecules to create potential therapeutic agents, targeting various medical conditions and diseases.
Used in Agrochemical Industry:
5,6-DIAMINO-2-(2-PROPOXYPHENYL)-4(1H)PYRIMIDINONE also finds application in the agrochemical industry, where it is utilized as a starting material for the synthesis of novel pesticides, herbicides, and other crop protection agents. Its incorporation into these products can lead to enhanced efficacy and selectivity, ultimately contributing to increased agricultural productivity and sustainability.
Used in Dye and Pigment Industry:
In the dye and pigment industry, 5,6-DIAMINO-2-(2-PROPOXYPHENYL)-4(1H)PYRIMIDINONE is used as a precursor for the synthesis of various dyes and pigments. Its yellow solid form can be further processed to produce a range of colors, which are then used in various applications such as textiles, plastics, and printing inks.
Used in Research and Development:
5,6-DIAMINO-2-(2-PROPOXYPHENYL)-4(1H)PYRIMIDINONE is also employed in research and development settings, where it serves as a valuable tool for understanding the fundamental chemical reactions and mechanisms involved in organic synthesis. Its use in this context can lead to the discovery of new synthetic routes, novel compounds, and innovative applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 57075-34-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,0,7 and 5 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 57075-34:
(7*5)+(6*7)+(5*0)+(4*7)+(3*5)+(2*3)+(1*4)=130
130 % 10 = 0
So 57075-34-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N4O2/c1-2-7-19-9-6-4-3-5-8(9)12-16-11(15)10(14)13(18)17-12/h3-6H,2,7,14H2,1H3,(H3,15,16,17,18)
