57105-42-7 Usage
Description
N-(3-Indolylacetyl)-L-valine, also known as Indole-3-acetyl-L-valine, is an indole-3-acetyl-amino acid conjugate that plays a significant role in the regulatory mechanisms controlling auxin activity. N-(3-Indolylacetyl)-L-valine is involved in various physiological and pathophysiological responses, making it a crucial component in the study of plant growth and development.
Uses
Used in Plant Physiology and Development:
N-(3-Indolylacetyl)-L-valine is used as a regulatory compound for controlling auxin activity, which is essential for various aspects of plant growth and development. Its role in modulating auxin activity allows it to influence processes such as cell elongation, division, and differentiation.
Used in Agricultural Applications:
In the agricultural industry, N-(3-Indolylacetyl)-L-valine can be used as a growth regulator to enhance crop yield and quality. By controlling auxin activity, this compound can potentially improve plant resistance to biotic and abiotic stresses, leading to more robust and productive crops.
Used in Pharmaceutical Research:
N-(3-Indolylacetyl)-L-valine may also have applications in the pharmaceutical industry, particularly in the development of drugs targeting auxin-related pathways. Understanding the role of this compound in regulating auxin activity can provide insights into the development of new therapeutic strategies for various diseases and conditions.
Used in Environmental Science:
In environmental science, N-(3-Indolylacetyl)-L-valine can be utilized in the study of plant-microbe interactions and ecosystem dynamics. Its involvement in auxin regulation can help researchers understand how plants respond to environmental changes and how they interact with other organisms in their environment.
Overall, N-(3-Indolylacetyl)-L-valine is a versatile compound with potential applications in various fields, including plant physiology, agriculture, pharmaceutical research, and environmental science. Its role in regulating auxin activity makes it a valuable tool for understanding and manipulating plant growth and development.
Check Digit Verification of cas no
The CAS Registry Mumber 57105-42-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,1,0 and 5 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 57105-42:
(7*5)+(6*7)+(5*1)+(4*0)+(3*5)+(2*4)+(1*2)=107
107 % 10 = 7
So 57105-42-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2O3/c1-9(2)14(15(19)20)17-13(18)7-10-8-16-12-6-4-3-5-11(10)12/h3-6,8-9,14,16H,7H2,1-2H3,(H,17,18)(H,19,20)
