57297-16-2 Usage
Description
(S)-[(6,7-dichloro-2,3-dihydro-2-methyl-1-oxo-2-phenyl-1H-inden-5-yl)oxy]acetic acid is a complex organic acid derivative of indene, characterized by its chlorinated and methylated bicyclic aromatic structure. With a molecular formula of C18H14Cl2O4, this compound features a carboxylic acid group, which may contribute to its potential pharmaceutical or medicinal applications. Further research and testing are required to explore its properties and possible uses.
Uses
Used in Pharmaceutical Industry:
(S)-[(6,7-dichloro-2,3-dihydro-2-methyl-1-oxo-2-phenyl-1H-inden-5-yl)oxy]acetic acid is used as a potential pharmaceutical compound for its unique structural features and functional groups. Its chlorinated and methylated structure, along with the carboxylic acid group, may offer novel therapeutic opportunities in drug development.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (S)-[(6,7-dichloro-2,3-dihydro-2-methyl-1-oxo-2-phenyl-1H-inden-5-yl)oxy]acetic acid serves as a valuable compound for studying its interactions with biological targets. Its complex structure and functional groups may provide insights into new mechanisms of action or novel drug candidates for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 57297-16-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,2,9 and 7 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 57297-16:
(7*5)+(6*7)+(5*2)+(4*9)+(3*7)+(2*1)+(1*6)=152
152 % 10 = 2
So 57297-16-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H14Cl2O4/c1-18(11-5-3-2-4-6-11)8-10-7-12(24-9-13(21)22)15(19)16(20)14(10)17(18)23/h2-7H,8-9H2,1H3,(H,21,22)/t18-/m0/s1