57521-63-8 Usage
Description
2,4-diamino-6-chloromethylpteridine is a pteridine derivative with the molecular formula C7H8N6Cl. It features two amino and one chloromethyl groups attached to its core structure, which contributes to its unique properties and potential applications.
Uses
Used in Pharmaceutical Industry:
2,4-diamino-6-chloromethylpteridine is used as a chemical compound for its potential role in the development of pharmaceuticals. Its unique structure allows it to be a promising candidate for creating new drugs and therapies.
Used as a Reagent in Chemical Reactions:
In the field of chemistry, 2,4-diamino-6-chloromethylpteridine serves as a reagent that facilitates various chemical reactions. Its functional groups enable it to participate in a range of processes, making it a valuable tool for researchers and chemists.
Used in Biochemical Research:
2,4-diamino-6-chloromethylpteridine is also of interest in biochemistry, where it is being investigated for its role in different biological processes. Its presence in studies can help scientists better understand certain mechanisms and develop targeted treatments or interventions.
Check Digit Verification of cas no
The CAS Registry Mumber 57521-63-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,5,2 and 1 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 57521-63:
(7*5)+(6*7)+(5*5)+(4*2)+(3*1)+(2*6)+(1*3)=128
128 % 10 = 8
So 57521-63-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClN6/c8-1-3-2-11-6-4(12-3)5(9)13-7(10)14-6/h2H,1H2,(H4,9,10,11,13,14)
57521-63-8Relevant articles and documents
A new, general and regioselective method for the synthesis of 2,6-disubstituted 4-aminopteridines
Taghavi-Moghadam, Shahriyar,Pfleiderer, Wolfgang
, p. 6835 - 6836 (2007/10/03)
A new synthetic method for the preparation of 2,6-disubstituted 4-aminopteridines is described. Treatment of a-substituted 4,5,6-triaminopyrimidines with α-ketoaldoximes in MeOH affords in a regioselective one-step reaction 2,6-disubstituted 4-aminopteridines in high yield.
