57531-87-0 Usage
General Description
2,4,5-Trichloro-6-methoxyisophthalonitrile, also known as teflubenzuron, is a chemical compound commonly used as an insect growth regulator. It is an effective pesticide that disrupts the development of insect larvae by inhibiting the formation of the exoskeleton, leading to their eventual death. Teflubenzuron is commonly used in agriculture to control a variety of pests, particularly those that infest crops and stored products. The compound is known for its specificity to insects and minimal impact on non-target organisms, making it a popular choice for pest control. However, its use is regulated in many countries due to potential environmental and health risks associated with its application.
Check Digit Verification of cas no
The CAS Registry Mumber 57531-87-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,5,3 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 57531-87:
(7*5)+(6*7)+(5*5)+(4*3)+(3*1)+(2*8)+(1*7)=140
140 % 10 = 0
So 57531-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H3Cl3N2O/c1-15-9-5(3-14)6(10)4(2-13)7(11)8(9)12/h1H3
