57667-10-4 Usage
Properties
1. Molecular formula: C12H6BrNO
2. Contains a nitrile functional group
3. Contains a bromo-substituted phenyl group
4. Furan derivative
Specific content
1. Used as a building block in organic synthesis
2. Potential applications in the pharmaceutical and agrochemical industries
3. May be used as a research tool in chemical and biological studies
4. Versatile intermediate for the synthesis of biologically active molecules and functional materials
5. Presence of bromo and nitrile groups on the furan ring.
Check Digit Verification of cas no
The CAS Registry Mumber 57667-10-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,6,6 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 57667-10:
(7*5)+(6*7)+(5*6)+(4*6)+(3*7)+(2*1)+(1*0)=154
154 % 10 = 4
So 57667-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H6BrNO/c12-9-3-1-8(2-4-9)11-6-5-10(7-13)14-11/h1-6H
57667-10-4Relevant articles and documents
A convenient reagent for the conversion of aldoximes into nitriles and isonitriles
Zhang, Wei,Lin, Jin-Hong,Zhang, Pengfei,Xiao, Ji-Chang
supporting information, p. 6221 - 6224 (2020/06/29)
For the dehydroxylation of aldoximes with 4-nitro-1-((trifluoromethyl)sulfonyl)-imidazole (NTSI), slight modifications of reaction conditions resulted in significantly different reaction paths to provide either nitriles or isonitriles. The challenging conversion of aldoximes into isonitriles was achieved under mild conditions.