58827-68-2 Usage
Description
rac 4-[4-(Oxiranylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine, with the CAS number 58827-68-2, is a chemical compound that is characterized as a yellow solid. It is primarily recognized for its utility in the field of organic synthesis, where it serves as a valuable building block for the creation of more complex molecules and structures.
Uses
Used in Organic Synthesis:
rac 4-[4-(Oxiranylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine is used as a synthetic intermediate for the development of various organic compounds. Its unique chemical structure, which includes a morpholine ring and a 1,2,5-thiadiazol-3-yl group, allows it to participate in a range of chemical reactions, facilitating the synthesis of diverse molecules with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, rac 4-[4-(Oxiranylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine is used as a key component in the synthesis of new drugs and drug candidates. Its ability to form a variety of chemical bonds and its compatibility with other molecular structures make it a promising candidate for the development of novel therapeutic agents.
Used in Chemical Research:
rac 4-[4-(Oxiranylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine is also utilized in chemical research as a model compound for studying various reaction mechanisms and exploring new synthetic pathways. Its unique properties and reactivity can provide valuable insights into the behavior of similar compounds and contribute to the advancement of chemical knowledge.
Used in Material Science:
In the field of material science, rac 4-[4-(Oxiranylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine may be employed as a component in the development of new materials with specific properties. Its incorporation into polymers or other materials could potentially enhance their performance, leading to innovative applications in various industries.
Overall, rac 4-[4-(Oxiranylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine is a versatile compound with a wide range of applications across different industries, primarily due to its unique chemical structure and its role in organic synthesis. Its potential for use in pharmaceuticals, chemical research, and material science highlights its importance in the development of new products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 58827-68-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,8,2 and 7 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 58827-68:
(7*5)+(6*8)+(5*8)+(4*2)+(3*7)+(2*6)+(1*8)=172
172 % 10 = 2
So 58827-68-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H13N3O3S/c1-3-13-4-2-12(1)8-9(11-16-10-8)15-6-7-5-14-7/h7H,1-6H2
