58986-28-0 Usage
General Description
Sodium ethyl 3-oxidoacrylate is a chemical compound composed of sodium, ethyl, and 3-oxidoacrylate. 3-oxidoacrylate is a derivative of acrylate, a common type of chemical compound used in various industrial processes. It is commonly employed in the production of polymers, adhesives, coatings, and other materials. Additionally, sodium ethyl 3-oxidoacrylate can also be used as a building block in organic synthesis, serving as a key component in the creation of more complex chemicals. Its combination of sodium and ethyl groups adds unique properties and characteristics to its chemical structure, making it valuable in a variety of applications within the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 58986-28-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,9,8 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 58986-28:
(7*5)+(6*8)+(5*9)+(4*8)+(3*6)+(2*2)+(1*8)=190
190 % 10 = 0
So 58986-28-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H8O3/c1-2-8-5(7)3-4-6/h3-4,6H,2H2,1H3/b4-3+
