5900-45-8 Usage
General Description
2-[5-Cyano-6-methyl-2,4-dioxo-3,4-dihydro-(2H)-pyrimidin-1-yl]acetic acid is a chemical compound with the molecular formula C9H8N2O4. It is a derivative of pyrimidine and is commonly used in pharmaceutical research and drug development. The compound has potential applications in the treatment of various diseases, including cancer and inflammatory disorders, due to its ability to inhibit specific enzymes and cellular processes. Additionally, it may also have uses in the field of organic synthesis and as a building block for the development of new chemical compounds. 2-[5-Cyano-6-methyl-2,4-dioxo-3,4-dihydro-(2H)-pyrimidin-1-yl]acetic acid is of interest due to its unique structure and potential biological activities, making it an important target for further study and investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 5900-45-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,9,0 and 0 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5900-45:
(6*5)+(5*9)+(4*0)+(3*0)+(2*4)+(1*5)=88
88 % 10 = 8
So 5900-45-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O4/c1-4-5(2-9)7(14)10-8(15)11(4)3-6(12)13/h3H2,1H3,(H,12,13)(H,10,14,15)