59301-25-6 Usage
General Description
5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine is a chemical compound with the molecular formula C7H6BrN3. It is a triazole derivative containing an amine group and a bromophenyl substituent. 5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine is commonly used in research and pharmaceutical drug development due to its potential biological activities, such as antifungal and antibacterial properties. It may also have applications in the synthesis of other organic compounds and materials. The chemical structure of 5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine makes it an important building block for creating novel compounds with various potential medicinal and industrial uses.
Check Digit Verification of cas no
The CAS Registry Mumber 59301-25-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,3,0 and 1 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 59301-25:
(7*5)+(6*9)+(5*3)+(4*0)+(3*1)+(2*2)+(1*5)=116
116 % 10 = 6
So 59301-25-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrN4/c9-6-4-2-1-3-5(6)7-11-8(10)13-12-7/h1-4H,(H3,10,11,12,13)