59532-52-4 Usage
Description
(1S,7aR)-2,3,5,7a-Tetrahydro-1β-hydroxy-1H-pyrrolizine-7-methanol divalerate is a complex organic compound belonging to the alkaloid and derivatives class. It is a derivative of pyrrolizidines, which are naturally occurring compounds found in various plants. This chemical has a unique structure and is primarily used in research and pharmaceutical applications. Its potential medicinal properties are currently under investigation, with further studies needed to determine its specific uses and effects. The divalerate form of this compound is derived from valeric acid, a fatty acid found in natural sources such as plants and oils. (1S,7aR)-2,3,5,7a-Tetrahydro-1β-hydroxy-1H-pyrrolizine-7-methanol divalerate is of significant interest to researchers and scientists in the fields of chemistry, pharmacology, and biochemistry.
Uses
Used in Pharmaceutical Research:
(1S,7aR)-2,3,5,7a-Tetrahydro-1β-hydroxy-1H-pyrrolizine-7-methanol divalerate is used as a research compound for exploring its potential medicinal properties and applications in the pharmaceutical industry. Its unique structure and alkaloid nature make it a promising candidate for further investigation into its therapeutic effects and possible uses in drug development.
Used in Chemical Research:
In the field of chemistry, (1S,7aR)-2,3,5,7a-Tetrahydro-1β-hydroxy-1H-pyrrolizine-7-methanol divalerate serves as a subject of study for understanding its complex structure and the properties of its constituent elements, such as valeric acid. This research can contribute to the broader understanding of organic compounds and their potential applications in various industries.
Used in Biochemical Studies:
(1S,7aR)-2,3,5,7a-Tetrahydro-1β-hydroxy-1H-pyrrolizine-7-methanol divalerate is utilized in biochemical studies to investigate its interactions with biological systems and potential effects on cellular processes. This research can provide valuable insights into the compound's biological activity and its potential role in medicine and other applications.
Check Digit Verification of cas no
The CAS Registry Mumber 59532-52-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,5,3 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59532-52:
(7*5)+(6*9)+(5*5)+(4*3)+(3*2)+(2*5)+(1*2)=144
144 % 10 = 4
So 59532-52-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H29NO4/c1-3-5-7-16(20)22-13-14-9-11-19-12-10-15(18(14)19)23-17(21)8-6-4-2/h9,15,18H,3-8,10-13H2,1-2H3/t15-,18?/m0/s1
