59543-75-8 Usage
Description
4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-amine is a chemical compound that features a thiazole ring fused with an indene ring. This amine derivative incorporates a sulfur atom within the thiazole ring and an amine group attached to it. 4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-amine's unique structure endows it with potential pharmaceutical applications, particularly due to its biological activity in the central nervous system. Its capacity to act as a ligand for various receptors or enzymes positions it as a promising candidate for medicinal chemistry research. Furthermore, the presence of the indene moiety hints at its utility in organic synthesis or as a component in the construction of more intricate molecular structures.
Uses
Used in Pharmaceutical Industry:
4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-amine is utilized as a prospective pharmaceutical agent for its demonstrated biological activity, especially within the central nervous system. Its structure allows it to potentially engage with multiple receptors or enzymes, making it a valuable compound for the development of new medications.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-amine serves as an intriguing subject for research. Its capacity to act as a ligand for various biological targets suggests its potential use in the discovery and optimization of novel therapeutic agents.
Used in Organic Synthesis:
4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-amine's structure, featuring the indene moiety, indicates that 4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-amine could be employed as a building block in organic synthesis. This application could lead to the creation of more complex molecules with diverse applications.
Used in Chemical Compound Development:
Due to its unique structure and potential reactivity, 4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-amine may be used in the development of new chemical compounds, particularly those with applications in various industries such as pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 59543-75-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,5,4 and 3 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 59543-75:
(7*5)+(6*9)+(5*5)+(4*4)+(3*3)+(2*7)+(1*5)=158
158 % 10 = 8
So 59543-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2S/c13-12-14-11(7-15-12)10-5-4-8-2-1-3-9(8)6-10/h4-7H,1-3H2,(H2,13,14)
