5965-38-8 Usage
Description
Cobalt(II) oxalate dihydrate is a rose red powder that is a coordination compound consisting of cobalt ions and oxalate ions. It is known for its unique chemical properties and has various applications across different industries.
Uses
Used in Chemical Industry:
Cobalt(II) oxalate dihydrate is used as a stabilizer for hydrogen cyanide, which is crucial in preventing the decomposition of hydrogen cyanide into toxic gases. This application is essential for maintaining the safety and stability of the chemical compound during various chemical processes.
Used as a Temperature Indicator:
Cobalt(II) oxalate dihydrate serves as a temperature indicator due to its color change properties. It can be used to monitor and control the temperature in various chemical reactions, ensuring that the desired conditions are maintained for optimal results.
Used in Catalyst Preparation:
Cobalt(II) oxalate dihydrate is employed in the preparation of cobalt catalysts, which are essential in various chemical reactions and processes. These catalysts play a vital role in increasing the rate of reactions, leading to more efficient and faster outcomes.
Used in Powder Metallurgy:
Cobalt(II) oxalate dihydrate is also used in the production of cobalt metal powder for powder-metallurgical applications. This process involves the creation of metal powders that can be used in various manufacturing techniques, such as sintering and hot isostatic pressing, to produce high-quality metal components with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 5965-38-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,9,6 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5965-38:
(6*5)+(5*9)+(4*6)+(3*5)+(2*3)+(1*8)=128
128 % 10 = 8
So 5965-38-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H13ClN2O4S/c1-3-4-18-14(21)9(13(20)17-15(18)23)5-8-6-10(16)12(19)11(7-8)22-2/h3,5-7,19H,1,4H2,2H3,(H,17,20,23)/b9-5-
5965-38-8Relevant articles and documents
Catena-Poly [[diaquacobalt(II)]-μ-oxalato]
Bacsa, John,Eve, Desmond,Dunbar, Kim R.
, p. m58-m60 (2007/10/03)
Single crystals of the title compound, [Co(C2O 4)(H2O)2]n, have been prepared by hydrothermal methods and characterized by X-ray diffraction analysis. The crystal structure consists of infinite one-di