59957-92-5 Usage
General Description
A-Tetrasaccharide is a chemical compound composed of four sugar molecules connected together. It is a type of carbohydrate that can be found in various natural sources such as plants, fruits, and vegetables. A-Tetrasaccharide is often utilized in the food industry as a sweetening agent, as well as in pharmaceutical and cosmetic products. A-TETRASACCHARIDE plays a crucial role in various biological processes, including energy production and cell signaling. A-Tetrasaccharide is also studied for its potential health benefits, such as its antioxidant and anti-inflammatory properties, making it an important compound in the field of nutrition and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 59957-92-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,9,5 and 7 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59957-92:
(7*5)+(6*9)+(5*9)+(4*5)+(3*7)+(2*9)+(1*2)=195
195 % 10 = 5
So 59957-92-5 is a valid CAS Registry Number.
InChI:InChI=1/C26H45NO20/c1-7-14(35)19(40)20(41)25(42-7)47-23-22(46-24-13(27-8(2)32)18(39)16(37)11(5-30)43-24)17(38)12(6-31)44-26(23)45-21(10(34)4-29)15(36)9(33)3-28/h3,7,9-26,29-31,33-41H,4-6H2,1-2H3,(H,27,32)/t7-,9-,10+,11+,12+,13+,14+,15+,16-,17-,18+,19+,20-,21?,22-,23+,24+,25-,26-/m0/s1