600135-89-5 Usage
Description
(3S,4R)-4-(4-Fluorophenyl)-3-[[3-methoxy-4-(phenylmethoxy)phenoxy]methyl]piperidine is a complex organic compound with a specific stereochemistry and a unique molecular structure. It is characterized by its chemical properties as a thick brown oil.
Uses
Used in Pharmaceutical Industry:
(3S,4R)-4-(4-Fluorophenyl)-3-[[3-methoxy-4-(phenylmethoxy)phenoxy]methyl]piperidine is used as an intermediate in the synthesis of Paroxetine and some major metabolites of Paroxetine. Paroxetine is a selective serotonin reuptake inhibitor (SSRI) commonly used as an antidepressant medication, treating conditions such as depression, anxiety, and obsessive-compulsive disorder. (3S,4R)-4-(4-Fluorophenyl)-3-[[3-methoxy-4-(phenylmethoxy)phenoxy]methyl]piperidine's role as an intermediate in the synthesis process is crucial for the production of these important pharmaceuticals.
Used in Chemical Research:
(3S,4R)-4-(4-Fluorophenyl)-3-[[3-methoxy-4-(phenylmethoxy)phenoxy]methyl]piperidine may also be utilized in chemical research and development, particularly in the field of medicinal chemistry. Its unique structure and stereochemistry make it a valuable compound for studying the effects of molecular modifications on the properties and activities of related compounds. This can lead to the discovery of new drugs or the improvement of existing ones.
Check Digit Verification of cas no
The CAS Registry Mumber 600135-89-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,0,0,1,3 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 600135-89:
(8*6)+(7*0)+(6*0)+(5*1)+(4*3)+(3*5)+(2*8)+(1*9)=105
105 % 10 = 5
So 600135-89-5 is a valid CAS Registry Number.
InChI:InChI=1/C26H28FNO3/c1-29-26-15-23(11-12-25(26)31-17-19-5-3-2-4-6-19)30-18-21-16-28-14-13-24(21)20-7-9-22(27)10-8-20/h2-12,15,21,24,28H,13-14,16-18H2,1H3/t21-,24-/m0/s1
600135-89-5Relevant articles and documents
Synthesis of the major metabolites of Paroxetine
Segura, Mireia,Roura, Lidia,De La Torre, Rafael,Joglar, Jesus
, p. 248 - 258 (2007/10/03)
Paroxetine is a well-known antidepressant, used worldwide in therapeutics. In comparison with other selective serotonin reuptake inhibitors, it exhibits the highest activity in serotonin reuptake inhibition. Paroxetine metabolism initially involves its demethylenation to the catechol intermediate, which is then O-methylated at positions C3 or C4. Herein, the chemistry resulting in the syntheses of these metabolites (3S,4R)-4-(4-fluorophenyl)-3-(hydroxymethyl)piperidine and (3S,4R)-4-(4-fluorophenyl)-3-(4-hydroxy-3-methoxyphenoxymethyl)piperidine is described starting from the common intermediate (3S,4R)-4-(4-fluorophenyl)-3-hydroxymethyl-1-methylpiperidine. Additionally, the common intermediate was used to synthesize paroxetine, which had the same structure and stereochemistry as commercial paroxetine, thereby confirming our synthetic route.