60021-32-1 Usage
Description
4-Hydroxyestriol is a byproduct in the synthesis of 2-Hydroxyestriol (H949313), which is utilized to characterize oxidative metabolites of 17β-estradiol and estrone formed by 15 selectively expressed human cytochrome P450 isoforms. It plays a significant role in understanding the metabolic pathways of these hormones and their potential effects on human health.
Uses
Used in Pharmaceutical Research:
4-Hydroxyestriol is used as a research compound for studying the metabolism of 17β-estradiol and estrone, which are essential hormones in the human body. Understanding the metabolic pathways of these hormones can provide insights into their roles in various physiological processes and potential therapeutic applications.
Used in Drug Development:
4-Hydroxyestriol is used as a reference compound in the development of drugs targeting the cytochrome P450 isoforms, which are involved in the metabolism of numerous drugs and endogenous compounds. This can help in designing more effective and safer medications with reduced side effects.
Used in Analytical Chemistry:
4-Hydroxyestriol is used as a standard or reference material in analytical chemistry for the identification and quantification of related metabolites in biological samples. This can be particularly useful in clinical and toxicological studies, as well as in the development of new analytical methods for detecting and measuring these compounds.
Used in Endocrinology:
4-Hydroxyestriol is used as a research tool in endocrinology to study the effects of 17β-estradiol and estrone on various physiological processes, such as reproductive health, bone metabolism, and cardiovascular function. This can contribute to a better understanding of the roles of these hormones in maintaining overall health and well-being.
Check Digit Verification of cas no
The CAS Registry Mumber 60021-32-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,0,2 and 1 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 60021-32:
(7*6)+(6*0)+(5*0)+(4*2)+(3*1)+(2*3)+(1*2)=61
61 % 10 = 1
So 60021-32-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H24O4/c1-18-7-6-10-9-4-5-14(19)16(21)12(9)3-2-11(10)13(18)8-15(20)17(18)22/h4-5,10-11,13,15,17,19-22H,2-3,6-8H2,1H3/t10-,11-,13+,15-,17+,18+/m1/s1