602-40-4 Usage
Chemical class
Organic compound
It is a type of chemical compound that contains carbon and hydrogen atoms.
Derivation
Derived from tropane alkaloids
Tropane alkaloids are a group of naturally occurring organic compounds that have a tropane core structure.
Use
Pharmaceutical drug production
It is used in the creation of drugs due to its potential therapeutic properties.
Molecular structure
Dibenzo cycloheptene core and tropane ester group
The compound has a unique structure consisting of a dibenzo cycloheptene core and a tropane ester group attached to it.
Potential therapeutic properties
Anti-inflammatory, analgesic, and effects on the central nervous system
It has been studied for its potential to reduce inflammation, relieve pain, and influence the central nervous system.
Investigations
Psychoactive substance and treatment of medical conditions
The compound has been investigated for its potential as a psychoactive substance and its use in treating various medical conditions.
Stereochemistry
(1R,5S)-configuration
The compound has a specific stereochemistry, with the R-configuration at the 1st carbon and the S-configuration at the 5th carbon.
Functional groups
Carboxylic acid and ester groups
The molecule contains a carboxylic acid group (-COOH) and an ester group (-COO-), which contribute to its reactivity and properties.
Solubility
Likely soluble in organic solvents
Due to its nonpolar nature, the compound is likely to be soluble in organic solvents like ethanol, methanol, or dichloromethane.
Stability
Stable under normal conditions
The compound is expected to be stable under normal conditions, such as room temperature and pressure, and in the absence of strong acids or bases.
Melting point
Not specified, but likely solid at room temperature
The exact melting point is not provided, but based on its molecular structure, it is likely to be a solid at room temperature.
Boiling point
Not specified, but likely high due to its molecular size and complexity
The exact boiling point is not provided, but the compound's large size and complexity suggest it would have a high boiling point.
Polarity
Moderately polar due to the presence of polar functional groups
The presence of the carboxylic acid and ester groups makes the molecule moderately polar, which can influence its interactions with other molecules and its solubility in different solvents.
Check Digit Verification of cas no
The CAS Registry Mumber 602-40-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,0 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 602-40:
(5*6)+(4*0)+(3*2)+(2*4)+(1*0)=44
44 % 10 = 4
So 602-40-4 is a valid CAS Registry Number.
InChI:InChI=1/C24H27NO2/c1-25-18-12-13-19(25)15-20(14-18)27-24(26)23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+