60290-23-5 Usage
General Description
4-Amino-5-azaindole is a heterocyclic compound that consists of a five-membered ring containing nitrogen. It is a derivative of indole and has a molecular formula of C7H7N3. 4-Amino-5-azaindole has potential applications in the pharmaceutical industry, as it is a building block for the synthesis of various biologically active molecules. It has been studied for its potential use in the development of new drugs for a range of medical conditions. Additionally, 4-Amino-5-azaindole has been investigated for its role as a catalyst in organic synthesis, particularly in the formation of carbon-carbon and carbon-heteroatom bonds. Its unique chemical properties make it a valuable compound for research and development in both the pharmaceutical and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 60290-23-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,2,9 and 0 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 60290-23:
(7*6)+(6*0)+(5*2)+(4*9)+(3*0)+(2*2)+(1*3)=95
95 % 10 = 5
So 60290-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3/c8-7-5-1-3-9-6(5)2-4-10-7/h1-4,9H,(H2,8,10)
