6035-47-8 Usage
Description
Sodium formaldehydesulfoxylate dihydrate, also known as sodium hydroxymethanesulfinate dihydrate, is a white crystalline powder that serves as a sulfur-containing reducing agent. It is commonly used in various industries for its unique chemical properties and versatile applications.
Uses
Used in Pharmaceutical Industry:
Sodium formaldehydesulfoxylate dihydrate is used as a preservative in the pharmaceutical industry due to its ability to maintain the stability and shelf life of medications.
Used in Organic Chemistry:
Sodium formaldehydesulfoxylate dihydrate is used as a versatile reagent in organic chemistry for a wide range of transformations, including:
1. As a SO2-2 anion source for the preparation of sulfones and sultines, which are important intermediates in the synthesis of various organic compounds.
2. For the debromination of vicinal dibromoalkanes, which helps in the synthesis of specific organic molecules by removing bromine atoms from the molecule.
3. In the reductive dehalogenation of aldehydes and ketones, which is a crucial step in the synthesis of various organic compounds by reducing the carbonyl group to form an alcohol.
Check Digit Verification of cas no
The CAS Registry Mumber 6035-47-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,0,3 and 5 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6035-47:
(6*6)+(5*0)+(4*3)+(3*5)+(2*4)+(1*7)=78
78 % 10 = 8
So 6035-47-8 is a valid CAS Registry Number.
InChI:InChI=1/CH4O3S.Na.2H2O/c2-1-5(3)4;;;/h2H,1H2,(H,3,4);;2*1H2/q;+1;;/p-1
