606493-11-2 Usage
General Description
3-(4-chlorophenyl)-2-methoxypropanoic acid is a chemical compound with an alphanumeric value for its name. This naming structure implies that it contains functional groups typically found in organic chemistry, which includes the presence of a chlorophenyl group, a methoxy group and a carboxylic acid group. The presence of chlorophenyl suggests the existence of a benzene ring in its structural blueprint, while the methoxy (–O–CH3) group and carboxylic acid (–COOH) group suggests carbon, hydrogen and oxygen mixtures. 3-(4-chlorophenyl)-2-methoxypropanoic acid, like many others in organic chemistry, could potentially participate in various chemical reactions to form different substances, but its specific properties and reactions depend on its particular molecular structure and the conditions under which it is studied. Its precise usages and roles in any biological or industrial context would require more specific context or research.
Check Digit Verification of cas no
The CAS Registry Mumber 606493-11-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,0,6,4,9 and 3 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 606493-11:
(8*6)+(7*0)+(6*6)+(5*4)+(4*9)+(3*3)+(2*1)+(1*1)=152
152 % 10 = 2
So 606493-11-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H11ClO3/c1-14-9(10(12)13)6-7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3,(H,12,13)